Triamcinolone Benetonide structure
|
Common Name | Triamcinolone Benetonide | ||
|---|---|---|---|---|
| CAS Number | 31002-79-6 | Molecular Weight | 623.70800 | |
| Density | 1.31 g/cm3 | Boiling Point | 782ºC at 760 mmHg | |
| Molecular Formula | C35H42FNO8 | Melting Point | 205ºC | |
| MSDS | N/A | Flash Point | 426.7ºC | |
Use of Triamcinolone BenetonideTriamcinolone benetonide is a synthetic glucocorticoid corticosteroid with anti-inflammatory activity. |
| Name | triamcinolone benetonide |
|---|---|
| Synonym | More Synonyms |
| Description | Triamcinolone benetonide is a synthetic glucocorticoid corticosteroid with anti-inflammatory activity. |
|---|---|
| Related Catalog | |
| Target |
Glucocorticoid Receptor[1] |
| References |
| Density | 1.31 g/cm3 |
|---|---|
| Boiling Point | 782ºC at 760 mmHg |
| Melting Point | 205ºC |
| Molecular Formula | C35H42FNO8 |
| Molecular Weight | 623.70800 |
| Flash Point | 426.7ºC |
| Exact Mass | 623.28900 |
| PSA | 128.23000 |
| LogP | 4.42670 |
| Index of Refraction | 1.596 |
| InChIKey | GUYPYYARYIIWJZ-CYEPYHPTSA-N |
| SMILES | CC(CNC(=O)c1ccccc1)C(=O)OCC(=O)C12OC(C)(C)OC1CC1C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC12C |
| Triamcinolona benetonido |
| Triamcinoloni benetonidum |
| Triamcinoloni benetonidum [INN-Latin] |
| UNII-9DXL8A82MI |
| Triamcinolona benetonido [INN-Spanish] |
| EINECS 250-427-3 |