Triamcinolone acetonide acetate structure
|
Common Name | Triamcinolone acetonide acetate | ||
|---|---|---|---|---|
| CAS Number | 3870-07-3 | Molecular Weight | 476.534 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 589.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C26H33FO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.3±30.1 °C | |
| Name | 21-(Acetyloxy) Triamcinolone Acetonide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 589.4±50.0 °C at 760 mmHg |
| Molecular Formula | C26H33FO7 |
| Molecular Weight | 476.534 |
| Flash Point | 310.3±30.1 °C |
| Exact Mass | 476.221039 |
| PSA | 99.13000 |
| LogP | 3.61 |
| Vapour Pressure | 0.0±3.8 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | VOBDXTSTTMAKHK-VHDCPBDGSA-N |
| SMILES | CC(=O)OCC(=O)C12OC(C)(C)OC1CC1C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC12C |
| Storage condition | 2~8℃ |
|
~%
Triamcinolone a... CAS#:3870-07-3 |
| Literature: Journal of the American Chemical Society, , vol. 80, p. 2338 US3048581 , ; |
|
~%
Triamcinolone a... CAS#:3870-07-3 |
| Literature: Journal of the American Chemical Society, , vol. 80, p. 2338 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Triamcinolone acetonide acetate |
| 2-(4b-Fluoro-5-hydroxy-4a,6a,8,8-tetramethyl-2-oxo-2,4a,4b,5,6,6a,9a,10,10a,10b,11,12-dodecahydro-6bH-naphtho[2',1':4,5]indeno[1,2-d][1,3]dioxol-6b-yl)-2-oxoethyl acetate |
| 2H-Naphth[2',1':4,5]indeno[1,2-d][1,3]dioxol-2-one, 6b-[2-(acetyloxy)acetyl]-4b-fluoro-4a,4b,5,6,6a,6b,9a,10,10a,10b,11,12-dodecahydro-5-hydroxy-4a,6a,8,8-tetramethyl- |
| Triamcinolone acetonide 21-acetate |