Pyridine,2-(4-fluorophenoxy)-5-nitro- structure
|
Common Name | Pyridine,2-(4-fluorophenoxy)-5-nitro- | ||
|---|---|---|---|---|
| CAS Number | 31011-26-4 | Molecular Weight | 234.18300 | |
| Density | 1.383g/cm3 | Boiling Point | 332.5ºC at 760mmHg | |
| Molecular Formula | C11H7FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.9ºC | |
| Name | 2-(4-fluorophenoxy)-5-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.383g/cm3 |
|---|---|
| Boiling Point | 332.5ºC at 760mmHg |
| Molecular Formula | C11H7FN2O3 |
| Molecular Weight | 234.18300 |
| Flash Point | 154.9ºC |
| Exact Mass | 234.04400 |
| PSA | 67.94000 |
| LogP | 3.44440 |
| Index of Refraction | 1.592 |
| InChIKey | WGCAKTXIGRVECX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc(F)cc2)nc1 |
| HS Code | 2933399090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(p-Fluorphenoxy)-5-nitropyridin |
| 2-(4-Fluoro-phenoxy)-5-nitro-pyridine |