Benzene,1-[2-(2-bromoethoxy)ethoxy]-2-chloro-4-nitro- structure
|
Common Name | Benzene,1-[2-(2-bromoethoxy)ethoxy]-2-chloro-4-nitro- | ||
|---|---|---|---|---|
| CAS Number | 31191-40-9 | Molecular Weight | 324.55600 | |
| Density | 1.573g/cm3 | Boiling Point | 428.6ºC at 760mmHg | |
| Molecular Formula | C10H11BrClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213ºC | |
| Name | 1-[2-(2-bromoethoxy)ethoxy]-2-chloro-4-nitrobenzene |
|---|
| Density | 1.573g/cm3 |
|---|---|
| Boiling Point | 428.6ºC at 760mmHg |
| Molecular Formula | C10H11BrClNO4 |
| Molecular Weight | 324.55600 |
| Flash Point | 213ºC |
| Exact Mass | 322.95600 |
| PSA | 64.28000 |
| LogP | 3.56170 |
| Index of Refraction | 1.57 |
| InChIKey | DZIBIMYQOCCZLA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OCCOCCBr)c(Cl)c1 |
|
~%
Benzene,1-[2-(2... CAS#:31191-40-9 |
| Literature: Baker,B.R.; Ashton,W.T. Journal of Medicinal Chemistry, 1970 , vol. 13, # 6 p. 1149 - 1154 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |