Benzenesulfonylfluoride, 4-[2-[2-(2-chloro-4-nitrophenoxy)ethoxy]ethoxy]- structure
|
Common Name | Benzenesulfonylfluoride, 4-[2-[2-(2-chloro-4-nitrophenoxy)ethoxy]ethoxy]- | ||
|---|---|---|---|---|
| CAS Number | 31191-52-3 | Molecular Weight | 419.80900 | |
| Density | 1.436g/cm3 | Boiling Point | 555.6ºC at 760 mmHg | |
| Molecular Formula | C16H15ClFNO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.8ºC | |
| Name | 4-[2-[2-(2-chloro-4-nitrophenoxy)ethoxy]ethoxy]benzenesulfonyl fluoride |
|---|
| Density | 1.436g/cm3 |
|---|---|
| Boiling Point | 555.6ºC at 760 mmHg |
| Molecular Formula | C16H15ClFNO7S |
| Molecular Weight | 419.80900 |
| Flash Point | 289.8ºC |
| Exact Mass | 419.02400 |
| PSA | 116.03000 |
| LogP | 4.98480 |
| Index of Refraction | 1.563 |
| InChIKey | HFPBKTXHEIHVKA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OCCOCCOc2ccc(S(=O)(=O)F)cc2)c(Cl)c1 |
|
~%
Benzenesulfonyl... CAS#:31191-52-3 |
| Literature: Baker,B.R.; Ashton,W.T. Journal of Medicinal Chemistry, 1970 , vol. 13, # 6 p. 1149 - 1154 |
|
~%
Benzenesulfonyl... CAS#:31191-52-3 |
| Literature: Baker,B.R.; Ashton,W.T. Journal of Medicinal Chemistry, 1970 , vol. 13, # 6 p. 1149 - 1154 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |