Benzene,1-(4-bromobutoxy)-3-nitro- structure
|
Common Name | Benzene,1-(4-bromobutoxy)-3-nitro- | ||
|---|---|---|---|---|
| CAS Number | 31191-44-3 | Molecular Weight | 274.11100 | |
| Density | 1.458g/cm3 | Boiling Point | 380.7ºC at 760mmHg | |
| Molecular Formula | C10H12BrNO3 | Melting Point | 62-63ºC | |
| MSDS | N/A | Flash Point | 184.1ºC | |
| Name | 1-(4-bromobutoxy)-3-nitrobenzene |
|---|
| Density | 1.458g/cm3 |
|---|---|
| Boiling Point | 380.7ºC at 760mmHg |
| Melting Point | 62-63ºC |
| Molecular Formula | C10H12BrNO3 |
| Molecular Weight | 274.11100 |
| Flash Point | 184.1ºC |
| Exact Mass | 273.00000 |
| PSA | 55.05000 |
| LogP | 3.67190 |
| Index of Refraction | 1.563 |
| InChIKey | DMPBIOHWAIAQPA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(OCCCCBr)c1 |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26;S37/S39 |
| HS Code | 2909309090 |
|
~93%
Benzene,1-(4-br... CAS#:31191-44-3 |
| Literature: Huang, Shao-Xu; Li, Hui-Yuan; Liu, Jun-Yan; Morisseau, Christophe; Hammock, Bruce D.; Long, Ya-Qiu Journal of Medicinal Chemistry, 2010 , vol. 53, # 23 p. 8376 - 8386 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |