bis(4-fluoro-3-nitrophenyl) sulfone structure
|
Common Name | bis(4-fluoro-3-nitrophenyl) sulfone | ||
|---|---|---|---|---|
| CAS Number | 312-30-1 | Molecular Weight | 344.248 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 531.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C12H6F2N2O6S | Melting Point | 191-194 °C(lit.) | |
| MSDS | N/A | Flash Point | 275.3±30.1 °C | |
| Name | 1-fluoro-4-(4-fluoro-3-nitrophenyl)sulfonyl-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 531.7±50.0 °C at 760 mmHg |
| Melting Point | 191-194 °C(lit.) |
| Molecular Formula | C12H6F2N2O6S |
| Molecular Weight | 344.248 |
| Flash Point | 275.3±30.1 °C |
| Exact Mass | 343.991455 |
| PSA | 134.16000 |
| LogP | 3.23 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | KHAWDEWNXJIVCJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)c2ccc(F)c([N+](=O)[O-])c2)ccc1F |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| RTECS | WR4300000 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2904909090 |
|
~%
bis(4-fluoro-3-... CAS#:312-30-1 |
| Literature: Chemische Berichte, , vol. 86, p. 172,180 |
|
~%
bis(4-fluoro-3-... CAS#:312-30-1 |
| Literature: Chemische Berichte, , vol. 86, p. 172,180 |
|
~%
bis(4-fluoro-3-... CAS#:312-30-1 |
| Literature: Chemische Berichte, , vol. 86, p. 172,180 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,1'-Sulfonylbis(4-fluoro-3-nitrobenzene) |
| p,p'-difluoro,m,m'-dinitrodiphenyl sulfone |
| MFCD00007057 |
| Benzene, 1,1'-sulfonylbis[4-fluoro-3-nitro- |
| Bis[4-fluoro-3-nitrophenyl] sulfone |
| EINECS 206-224-7 |
| 3,3'-dinitro-4,4'-difluorodiphenyl sulphone |
| 4,4'-Difluoro-3,3'-dinitrodiphenyl Sulfone |
| Difluorodinitrobenzene sulfone |
| 4-Fluoro-3-nitrophenyl sulfone |
| bis(4-fluoro-3-nitrophenyl) sulfone |
| Sulfone, bis[4-fluoro-3-nitrophenyl] |