2-Methyl-N-phenylmaleimide structure
|
Common Name | 2-Methyl-N-phenylmaleimide | ||
|---|---|---|---|---|
| CAS Number | 3120-04-5 | Molecular Weight | 187.19500 | |
| Density | 1.05 g/mL at 25ºC(lit.) | Boiling Point | 262-264ºC(lit.) | |
| Molecular Formula | C11H9NO2 | Melting Point | 98-100ºC(lit.) | |
| MSDS | N/A | Flash Point | >230 °F | |
| Name | 3-methyl-1-phenylpyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 262-264ºC(lit.) |
| Melting Point | 98-100ºC(lit.) |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.19500 |
| Flash Point | >230 °F |
| Exact Mass | 187.06300 |
| PSA | 37.38000 |
| LogP | 1.57110 |
| Index of Refraction | n20/D 1.568(lit.) |
| InChIKey | QAVUFFJVZGZJMO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(c2ccccc2)C1=O |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | 20/21/22-36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2925190090 |
| Precursor 8 | |
|---|---|
| DownStream 5 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-Methylphenylmaleimide |
| MFCD00075111 |
| 3-methyl-1-phenyl-1H-pyrrole-2,5-dione |
| 1h-pyrrole-2,5-dione,3-methyl-1-phenyl |
| N-phenylcitraconimide |
| 2-Methyl-N-phenylmaleimide |