IQ 3 structure
|
Common Name | IQ 3 | ||
|---|---|---|---|---|
| CAS Number | 312538-03-7 | Molecular Weight | 341.32000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H11N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of IQ 3IQ-3 is a specific inhibitor of the c-Jun N-terminal kinase (JNK) family, with preference for JNK3. IQ-3 exhibits Kd values of 0.24 μM, 0.29 μM and 0.066 μM for JNK1, JNK2 and JNK3, respectively. |
| Name | 11H-indeno[1,2-b]quinoxalin-11-one-O-(2-furoyl)oxime |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H11N3O3 |
|---|---|
| Molecular Weight | 341.32000 |
| Exact Mass | 341.08000 |
| PSA | 77.58000 |
| LogP | 3.81260 |
| InChIKey | WBSWWONMTZEOGS-PTGBLXJZSA-N |
| SMILES | O=C(ON=C1c2ccccc2-c2nc3ccccc3nc21)c1ccco1 |
| iq 3 |