2 6-BIS[(4R 5R)-4-METHYL-5-PHENYL-2-OXA& structure
|
Common Name | 2 6-BIS[(4R 5R)-4-METHYL-5-PHENYL-2-OXA& | ||
|---|---|---|---|---|
| CAS Number | 312624-05-8 | Molecular Weight | 397.46900 | |
| Density | 1.25g/cm3 | Boiling Point | 600.6ºC at 760mmHg | |
| Molecular Formula | C25H23N3O2 | Melting Point | 135-139ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 317.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (4R,5R)-4-methyl-2-[6-[(4R,5R)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyridin-2-yl]-5-phenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 600.6ºC at 760mmHg |
| Melting Point | 135-139ºC(lit.) |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.46900 |
| Flash Point | 317.1ºC |
| Exact Mass | 397.17900 |
| PSA | 56.07000 |
| LogP | 3.76600 |
| Index of Refraction | 1.655 |
| InChIKey | WAQJMWVRZVOTCH-AFXFGAOOSA-N |
| SMILES | CC1N=C(c2cccc(C3=NC(C)C(c4ccccc4)O3)n2)OC1c1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2934999090 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-bis[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]phenylboronic acid |
| 2,6-bis[(4R,5R)-4,5-dihydro-4-methyl-5-phenyl-2-oxazolyl]pyridine |
| 2,6-Bis[(2,2,6,6-tetramethyl-1-piperidinyl)methyl]phenylboronic Acid |
| MFCD01863587 |