YM 758 structure
|
Common Name | YM 758 | ||
|---|---|---|---|---|
| CAS Number | 312752-86-6 | Molecular Weight | 567.54400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H33FN3O8P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of YM 758A novel potent "funny" If current channel (If channel) inhibitor that inhibits rOct1- and hOCT1-mediated [3H]MPP uptake with IC50 of 23.8 and 40.5 uM, respectively. |
| Name | N-[2-[(3R)-3-[(3,4-Dihydro-6,7-dimethoxy-2(1H)-isoquinolinyl)carbonyl]-1-piperidinyl]ethyl]-4-fluorobenzamide Phosphate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H33FN3O8P |
|---|---|
| Molecular Weight | 567.54400 |
| Exact Mass | 567.21500 |
| PSA | 168.85000 |
| LogP | 3.70020 |
| InChIKey | ZYPKBNXZBIMKAY-VEIFNGETSA-N |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)C1CCCN(CCNC(=O)c3ccc(F)cc3)C1)CC2.O=P(O)(O)O |
| YM 758 Phosphate |
| YM 758 |
| (R)-(-)-N-[2-[3-[(6,7-Dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-yl)carbonyl]piperidino]ethyl]-4-fluorobenzamide monophosphate |