2,6-Bis(trifluoromethyl)aniline structure
|
Common Name | 2,6-Bis(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 313-13-3 | Molecular Weight | 229.122 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 171.6±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H5F6N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 67.9±16.6 °C | |
| Name | 2,6-bis(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 171.6±35.0 °C at 760 mmHg |
| Molecular Formula | C8H5F6N |
| Molecular Weight | 229.122 |
| Flash Point | 67.9±16.6 °C |
| Exact Mass | 229.032623 |
| PSA | 26.02000 |
| LogP | 4.16 |
| Vapour Pressure | 1.4±0.3 mmHg at 25°C |
| Index of Refraction | 1.423 |
| InChIKey | KEYVECAMLDRXSJ-UHFFFAOYSA-N |
| SMILES | Nc1c(C(F)(F)F)cccc1C(F)(F)F |
| HS Code | 2921420090 |
|---|
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,6-Bis(trifluoromethyl)benzenamine |
| FXFFR BZ CXFFF |
| 2,6-Bis(trifluoromethyl)aniline |