2,6-Bis(trifluoromethyl)aniline
2,6-Bis(trifluoromethyl)aniline structure
|
Common Name | 2,6-Bis(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 313-13-3 | Molecular Weight | 229.122 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 171.6±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H5F6N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 67.9±16.6 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6-bis(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 171.6±35.0 °C at 760 mmHg |
| Molecular Formula | C8H5F6N |
| Molecular Weight | 229.122 |
| Flash Point | 67.9±16.6 °C |
| Exact Mass | 229.032623 |
| PSA | 26.02000 |
| LogP | 4.16 |
| Vapour Pressure | 1.4±0.3 mmHg at 25°C |
| Index of Refraction | 1.423 |
| InChIKey | KEYVECAMLDRXSJ-UHFFFAOYSA-N |
| SMILES | Nc1c(C(F)(F)F)cccc1C(F)(F)F |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2921420090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 1 | |
CAS#:2377-33-5
CAS#:24821-23-6
CAS#:569-51-7
CAS#:24821-24-7
CAS#:402-31-3This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,6-Bis(trifluoromethyl)benzenamine |
| FXFFR BZ CXFFF |
| 2,6-Bis(trifluoromethyl)aniline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2,6-bis(trifluoromethyl)aniline? |
| A: The English name of 2,6-bis(trifluoromethyl)aniline is 2,6-bis(trifluoromethyl)aniline. |
| Q: What is the InChIKey of 2,6-bis(trifluoromethyl)aniline? |
| A: InChIKey of 2,6-bis(trifluoromethyl)aniline is KEYVECAMLDRXSJ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2,6-bis(trifluoromethyl)aniline? |
| A: CAS number of 2,6-bis(trifluoromethyl)aniline is 313-13-3. |
| Q: What is the polar surface area (PSA) of 2,6-bis(trifluoromethyl)aniline? |
| A: Polar surface area (PSA) of 2,6-bis(trifluoromethyl)aniline is 26.02000. |
| Q: What is the molecular weight of 2,6-bis(trifluoromethyl)aniline? |
| A: Molecular weight of 2,6-bis(trifluoromethyl)aniline is 229.122. |
| Q: What is the LogP of 2,6-bis(trifluoromethyl)aniline? |
| A: LogP of 2,6-bis(trifluoromethyl)aniline is 4.16. |
| Q: What is the boiling point of 2,6-bis(trifluoromethyl)aniline? |
| A: Boiling point of 2,6-bis(trifluoromethyl)aniline is 171.6±35.0 °C at 760 mmHg. |
| Q: What are the downstream products of 2,6-bis(trifluoromethyl)aniline? |
| A: Related downstream products(CAS) of 2,6-bis(trifluoromethyl)aniline: 402-31-3. |
| Q: What are the upstream materials of 2,6-bis(trifluoromethyl)aniline? |
| A: Related upstream materials(CAS) of 2,6-bis(trifluoromethyl)aniline: 2377-33-5;24821-23-6;569-51-7;24821-24-7. |
| Q: What English synonyms does 2,6-bis(trifluoromethyl)aniline have? |
| A: English synonyms of 2,6-bis(trifluoromethyl)aniline: 2,6-Bis(trifluoromethyl)benzenamine, FXFFR BZ CXFFF, 2,6-Bis(trifluoromethyl)aniline. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |