Benzene-1,2,3-tricarboxylic acid structure
|
Common Name | Benzene-1,2,3-tricarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 569-51-7 | Molecular Weight | 210.140 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 491.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H6O6 | Melting Point | ~195 °C (dec.) | |
| MSDS | N/A | Flash Point | 265.0±23.8 °C | |
| Name | Benzene-1,2,3-tricarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 491.3±40.0 °C at 760 mmHg |
| Melting Point | ~195 °C (dec.) |
| Molecular Formula | C9H6O6 |
| Molecular Weight | 210.140 |
| Flash Point | 265.0±23.8 °C |
| Exact Mass | 210.016434 |
| PSA | 111.90000 |
| LogP | -0.19 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | UJMDYLWCYJJYMO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(C(=O)O)c1C(=O)O |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| WGK Germany | 3 |
| HS Code | 2917399090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| HEMIMELLITIC ACID |
| EINECS 209-317-0 |
| benzenetricarboxylic acid |
| benzene-1,2,3-tricarboxylic acid |
| MFCD00002468 |
| 1,2,3-Benzenetricarboxylic acid |
| benzene tricarboxylic acid |