1,3-Bis(trifluoromethyl)benzene structure
|
Common Name | 1,3-Bis(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 402-31-3 | Molecular Weight | 214.108 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 116.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C8H4F6 | Melting Point | -35°C | |
| MSDS | Chinese USA | Flash Point | 26.1±0.0 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Warning | |
| Name | 1,3-Bis(trifluoromethyl)-benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 116.0±0.0 °C at 760 mmHg |
| Melting Point | -35°C |
| Molecular Formula | C8H4F6 |
| Molecular Weight | 214.108 |
| Flash Point | 26.1±0.0 °C |
| Exact Mass | 214.021713 |
| LogP | 3.64 |
| Vapour Pressure | 22.1±0.2 mmHg at 25°C |
| Index of Refraction | 1.380 |
| InChIKey | SJBBXFLOLUTGCW-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cccc(C(F)(F)F)c1 |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant;F: Flammable; |
| Risk Phrases | R10 |
| Safety Phrases | S26 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 3 |
| HS Code | 2903999090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
The Metalation of 1, 3-Bis (trifluoromethyl) benzene by n butyllithium. Aeberli P and Houlihan WJ.
J. Organomet. Chem. 67(3) , 321-25, (1974)
|
|
|
A site selective functionalisation of 1, 3-bis (trifluoromethyl) benzene. Dmowski W and Piasecka-Maciejewska K.
Tetrahedron 54(24) , 6781-92, (1998)
|
| 1,3-Bis(trifluoromethyl)benzene |
| α,α,α,α',α',α'-Hexafluoro-m-xylene |
| m-Ditrifluorotoluene |
| MTF-TFM |
| Hexafluoro-m-xylene |
| FXFFR CXFFF |
| MFCD00000392 |
| m-Ditrifluoromethylbenzene |
| α,α,α,α′,α′,α′-Hexafluoro-m-xylene |
| EINECS 206-939-4 |
| Metaxylene hexafluoride |
| Xylene hexafluoride |
| 1,3-TrifluoromethylBenzene |
| M-XYLENE HEXAFLUORIDE |