10-n-boc-amino-dec-1-ene structure
|
Common Name | 10-n-boc-amino-dec-1-ene | ||
|---|---|---|---|---|
| CAS Number | 313469-03-3 | Molecular Weight | 255.39600 | |
| Density | 0.9 g/cm3 | Boiling Point | 353.2ºC at 760 mmHg | |
| Molecular Formula | C15H29NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl N-dec-9-enylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9 g/cm3 |
|---|---|
| Boiling Point | 353.2ºC at 760 mmHg |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.39600 |
| Exact Mass | 255.22000 |
| PSA | 38.33000 |
| LogP | 4.81870 |
| Index of Refraction | 1.452 |
| InChIKey | NBZBQHNWIXSPLW-UHFFFAOYSA-N |
| SMILES | C=CCCCCCCCCNC(=O)OC(C)(C)C |
| HS Code | 2924199090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 10-N-Boc-amino-dec-1-ene |
| tert-butyl dec-9-enylcarbamate |
| n-boc-10-amino-1-decene |
| MFCD03001714 |