2-nitro-4-(1-phenylethenyl)aniline
2-nitro-4-(1-phenylethenyl)aniline structure
|
Common Name | 2-nitro-4-(1-phenylethenyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 90044-01-2 | Molecular Weight | 240.25700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-nitro-4-(1-phenylethenyl)aniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H12N2O2 |
|---|---|
| Molecular Weight | 240.25700 |
| Exact Mass | 240.09000 |
| PSA | 71.84000 |
| LogP | 4.34290 |
| InChIKey | CXQYKTNQBHZKQV-UHFFFAOYSA-N |
| SMILES | C=C(c1ccccc1)c1ccc(N)c([N+](=O)[O-])c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~62%
2-nitro-4-(1-ph... CAS#:90044-01-2 |
| Literature: SmithKline Beckman Corporation Patent: US4438135 A1, 1984 ; |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-nitro-4-(1-phenylethenyl)aniline? |
| A: SMILES notation of 2-nitro-4-(1-phenylethenyl)aniline is C=C(c1ccccc1)c1ccc(N)c([N+](=O)[O-])c1. |
| Q: What is the molecular formula of 2-nitro-4-(1-phenylethenyl)aniline? |
| A: Molecular formula of 2-nitro-4-(1-phenylethenyl)aniline is C14H12N2O2. |
| Q: What is the InChIKey of 2-nitro-4-(1-phenylethenyl)aniline? |
| A: InChIKey of 2-nitro-4-(1-phenylethenyl)aniline is CXQYKTNQBHZKQV-UHFFFAOYSA-N. |
| Q: What is the English name of 2-nitro-4-(1-phenylethenyl)aniline? |
| A: The English name of 2-nitro-4-(1-phenylethenyl)aniline is 2-nitro-4-(1-phenylethenyl)aniline. |
| Q: What is the molecular weight of 2-nitro-4-(1-phenylethenyl)aniline? |
| A: Molecular weight of 2-nitro-4-(1-phenylethenyl)aniline is 240.25700. |
| Q: What is the Chinese name of 90044-01-2? |
| A: Chinese name of 90044-01-2 is 90044-01-2. |
| Q: What is the polar surface area (PSA) of 2-nitro-4-(1-phenylethenyl)aniline? |
| A: Polar surface area (PSA) of 2-nitro-4-(1-phenylethenyl)aniline is 71.84000. |
| Q: What is the LogP of 2-nitro-4-(1-phenylethenyl)aniline? |
| A: LogP of 2-nitro-4-(1-phenylethenyl)aniline is 4.34290. |
| Q: What is the CAS number of 2-nitro-4-(1-phenylethenyl)aniline? |
| A: CAS number of 2-nitro-4-(1-phenylethenyl)aniline is 90044-01-2. |