2-Nitrodiphenyl sulfone structure
|
Common Name | 2-Nitrodiphenyl sulfone | ||
|---|---|---|---|---|
| CAS Number | 31515-43-2 | Molecular Weight | 263.269 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 462.3±28.0 °C at 760 mmHg | |
| Molecular Formula | C12H9NO4S | Melting Point | 145-148 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 233.4±24.0 °C | |
| Name | 2-Nitrophenyl phenyl sulfone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 462.3±28.0 °C at 760 mmHg |
| Melting Point | 145-148 °C(lit.) |
| Molecular Formula | C12H9NO4S |
| Molecular Weight | 263.269 |
| Flash Point | 233.4±24.0 °C |
| Exact Mass | 263.025238 |
| PSA | 88.34000 |
| LogP | 2.55 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | GKNMUCPEXSCGKC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)c1ccccc1 |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| HS Code | 2904909090 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Diarylsulfones, a new chemical class of nonnucleoside antiviral inhibitors of human immunodeficiency virus type 1 reverse transcriptase.
Antimicrob. Agents Chemother. 37(4) , 754-60, (1993) A series of variously substituted diarylsulfones and related derivatives were found to prevent human immunodeficiency virus type 1 (HIV-1) replication and HIV-1-induced cell killing in vitro. One of t... |
|
|
Synthesis of pyrryl aryl sulfones targeted at the HIV-1 reverse transcriptase.
Arch. Pharm. (Weinheim) 328(3) , 223-9, (1995) Various aryl 1-pyrryl sulfones were synthesized and tested as inhibitors of HIV-1. 2-Nitrophenyl-2-ethoxycarbonyl-1-pyrryl sulfone, the most active among test derivatives, was selected as lead compoun... |
| o-Nitrophenyl phenyl sulfone |
| Sulfone, o-nitrophenyl phenyl |
| Benzene, 1-nitro-2-(phenylsulfonyl)- |
| O-NITRO DIPHENYL SULFONE |
| 2-Nitrophenyl Phenyl Sulfone |
| 2-NITROPHENYL PHENYL SULPHONE |
| 2-Nitrophenyl phenyl |
| MFCD00035921 |
| 2-Nitrophenyl-phenyl-sulfon |
| 1-Nitro-2-(phenylsulfonyl)benzene |
| 2-Nitrodiphenyl sulfone |
| EINECS 250-672-6 |
| 2-nitrodiphenylsulfone |
| 2-Nitrodiphenyl sulphone |