2,2,6,6-Tetramethyl-4-piperidinyl methacrylate structure
|
Common Name | 2,2,6,6-Tetramethyl-4-piperidinyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 31582-45-3 | Molecular Weight | 225.327 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 273.0±33.0 °C at 760 mmHg | |
| Molecular Formula | C13H23NO2 | Melting Point | 61ºC | |
| MSDS | N/A | Flash Point | 118.9±25.4 °C | |
| Name | (2,2,6,6-tetramethylpiperidin-4-yl) 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 273.0±33.0 °C at 760 mmHg |
| Melting Point | 61ºC |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.327 |
| Flash Point | 118.9±25.4 °C |
| Exact Mass | 225.172882 |
| PSA | 38.33000 |
| LogP | 3.61 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.474 |
| InChIKey | UFLXKQBCEYNCDU-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OC1CC(C)(C)NC(C)(C)C1 |
| HS Code | 2933399090 |
|---|
|
~59%
2,2,6,6-Tetrame... CAS#:31582-45-3 |
| Literature: Journal of Polymer Science, Part A: Polymer Chemistry, , vol. 50, # 7 p. 1394 - 1407 |
|
~%
2,2,6,6-Tetrame... CAS#:31582-45-3 |
| Literature: Journal of the American Chemical Society, , vol. 129, # 46 p. 14128 - 14129 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| UFLXKQBCEYNCDU-UHFFFAOYSA |
| ADK Stab LA 87 |
| Methacrylic Acid 2,2,6,6-Tetramethyl-4-piperidyl Ester |
| 2,2,6,6-tetramethylpiperidine methacrylate |
| 2-Propenoic acid, 2-methyl-, 2,2,6,6-tetramethyl-4-piperidinyl ester |
| 4-methacryloyloxy-2,2,6,6-tetramethylpiperidine |
| 2,2,6,6-Tetramethylpiperidin-4-yl methacrylate |
| EINECS 250-718-5 |
| 2,2,6,6-Tetramethyl-4-piperidyl Methacrylate |
| 2,2,6,6-Tetramethylpiperid-4-yl methacrylate |
| Mark LA 87 |
| 2,2,6,6-Tetramethyl-4-piperidinyl methacrylate |
| Fancryl FA 712HM |