5,6,7,8-tetramethoxy-2-phenylchromen-4-one structure
|
Common Name | 5,6,7,8-tetramethoxy-2-phenylchromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 3162-43-4 | Molecular Weight | 342.34300 | |
| Density | 1.243g/cm3 | Boiling Point | 536.9ºC at 760mmHg | |
| Molecular Formula | C19H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.5ºC | |
| Name | 5,6,7,8-tetramethoxy-2-phenylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 536.9ºC at 760mmHg |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.34300 |
| Flash Point | 237.5ºC |
| Exact Mass | 342.11000 |
| PSA | 67.13000 |
| LogP | 3.49440 |
| Index of Refraction | 1.574 |
| InChIKey | HLBQIAYRCJIRCQ-UHFFFAOYSA-N |
| SMILES | COc1c(OC)c(OC)c2c(=O)cc(-c3ccccc3)oc2c1OC |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5,6,7,8-tetramethoxyflavone |
| 5,6,7,8-tetramethoxy-2-phenyl-chromen-4-one |
| Alnetin-methylaether |
| 5,6,7,8-Tetramethoxyflavon |
| 4H-1-Benzopyran-4-one,5,6,7,8-tetramethoxy-2-phenyl |
| 5,6,7,8-Tetramethoxy-2-phenyl-chromen-4-on |