O-1602 structure
|
Common Name | O-1602 | ||
|---|---|---|---|---|
| CAS Number | 317321-41-8 | Molecular Weight | 258.36 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 401.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.2±23.3 °C | |
Use of O-1602O-1602 is an agonist of GPR55[1]. |
| Name | 5-methyl-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzene-1,3-diol |
|---|---|
| Synonym | More Synonyms |
| Description | O-1602 is an agonist of GPR55[1]. |
|---|---|
| Related Catalog |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 401.6±45.0 °C at 760 mmHg |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 |
| Flash Point | 185.2±23.3 °C |
| Exact Mass | 258.161987 |
| PSA | 40.46000 |
| LogP | 4.91 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | KDZOUSULXZNDJH-LSDHHAIUSA-N |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(C)cc(O)cc1O |
| 1,3-Benzenediol, 5-methyl-4-[(1R,6R)-3-methyl-6-(1-methylethenyl)-2-cyclohexen-1-yl]- |
| O-1602 |
| 4-[(1R,6R)-6-Isopropenyl-3-methyl-2-cyclohexen-1-yl]-5-methyl-1,3-benzenediol |
| 5-Methyl-4-[(1R,6R)-3-methyl-6-(prop-1-en-2-yl)cyclohex-2-en-1-yl]benzene-1,3-diol |