2-chloro-6-(4-fluorophenyl)nicotinonitrile structure
|
Common Name | 2-chloro-6-(4-fluorophenyl)nicotinonitrile | ||
|---|---|---|---|---|
| CAS Number | 31776-83-7 | Molecular Weight | 232.64100 | |
| Density | 1.37g/cm3 | Boiling Point | 373.3ºC at 760mmHg | |
| Molecular Formula | C12H6ClFN2 | Melting Point | 173-176ºC | |
| MSDS | N/A | Flash Point | 179.5ºC | |
| Name | 2-chloro-6-(4-fluorophenyl)pyridine-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 373.3ºC at 760mmHg |
| Melting Point | 173-176ºC |
| Molecular Formula | C12H6ClFN2 |
| Molecular Weight | 232.64100 |
| Flash Point | 179.5ºC |
| Exact Mass | 232.02000 |
| PSA | 36.68000 |
| LogP | 3.41278 |
| Index of Refraction | 1.612 |
| InChIKey | VJYNNRPTVYPCCS-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(-c2ccc(F)cc2)nc1Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 3439 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2933399090 |
|
~73%
2-chloro-6-(4-f... CAS#:31776-83-7 |
| Literature: Li; Hong; Su Organic Preparations and Procedures International, 2009 , vol. 41, # 6 p. 533 - 538 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00215072 |
| 2-Chloro-3-cyano-6-(4-fluorophenyl)pyridine |
| 2-Chloro-6-(4-fluorophenyl)nicotinonitrile |