N-γ-L-glutamyl-4-aminobutyric acid
N-γ-L-glutamyl-4-aminobutyric acid structure
|
Common Name | N-γ-L-glutamyl-4-aminobutyric acid | ||
|---|---|---|---|---|
| CAS Number | 3183-72-0 | Molecular Weight | 232.23400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H16N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-γ-L-glutamyl-4-aminobutyric acid (Chinese name: N-γ-L-谷氨酰-4-氨基丁酸, CAS number: 3183-72-0), molecular formula C9H16N2O5, molecular weight 232.23400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-γ-L-glutamyl-4-aminobutyric acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H16N2O5 |
|---|---|
| Molecular Weight | 232.23400 |
| Exact Mass | 232.10600 |
| PSA | 129.72000 |
| LogP | 0.25070 |
| InChIKey | MKYPKZSGLSOGLL-LURJTMIESA-N |
| SMILES | NC(CCC(=O)NCCCC(=O)O)C(=O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2924199090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:1955-67-5
CAS#:56-12-2This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| γ-Glutamyl-γ-aminobuttersaeure |
| γ-L-Glutamyl-γ-aminobuttersaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 3183-72-0? |
| A: Chinese name of 3183-72-0 is 3183-72-0. |
| Q: What is the English name of N-γ-L-glutamyl-4-aminobutyric acid? |
| A: The English name of N-γ-L-glutamyl-4-aminobutyric acid is N-γ-L-glutamyl-4-aminobutyric acid. |
| Q: What is the polar surface area (PSA) of N-γ-L-glutamyl-4-aminobutyric acid? |
| A: Polar surface area (PSA) of N-γ-L-glutamyl-4-aminobutyric acid is 129.72000. |
| Q: What is the InChIKey of N-γ-L-glutamyl-4-aminobutyric acid? |
| A: InChIKey of N-γ-L-glutamyl-4-aminobutyric acid is MKYPKZSGLSOGLL-LURJTMIESA-N. |
| Q: What is the molecular formula of N-γ-L-glutamyl-4-aminobutyric acid? |
| A: Molecular formula of N-γ-L-glutamyl-4-aminobutyric acid is C9H16N2O5. |
| Q: What is the molecular weight of N-γ-L-glutamyl-4-aminobutyric acid? |
| A: Molecular weight of N-γ-L-glutamyl-4-aminobutyric acid is 232.23400. |
| Q: What is the LogP of N-γ-L-glutamyl-4-aminobutyric acid? |
| A: LogP of N-γ-L-glutamyl-4-aminobutyric acid is 0.25070. |
| Q: What are the downstream products of N-γ-L-glutamyl-4-aminobutyric acid? |
| A: Related downstream products(CAS) of N-γ-L-glutamyl-4-aminobutyric acid: 1955-67-5;56-12-2. |
| Q: What is the CAS number of N-γ-L-glutamyl-4-aminobutyric acid? |
| A: CAS number of N-γ-L-glutamyl-4-aminobutyric acid is 3183-72-0. |
| Q: What is the SMILES notation of N-γ-L-glutamyl-4-aminobutyric acid? |
| A: SMILES notation of N-γ-L-glutamyl-4-aminobutyric acid is NC(CCC(=O)NCCCC(=O)O)C(=O)O. |