1,4-Naphthalenedione,2-hydroxy-3-(methylthio)- structure
|
Common Name | 1,4-Naphthalenedione,2-hydroxy-3-(methylthio)- | ||
|---|---|---|---|---|
| CAS Number | 31914-17-7 | Molecular Weight | 220.24400 | |
| Density | 1.45g/cm3 | Boiling Point | 388.8ºC at 760 mmHg | |
| Molecular Formula | C11H8O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.9ºC | |
| Name | 4-hydroxy-3-methylsulfanylnaphthalene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 388.8ºC at 760 mmHg |
| Molecular Formula | C11H8O3S |
| Molecular Weight | 220.24400 |
| Flash Point | 188.9ºC |
| Exact Mass | 220.01900 |
| PSA | 79.67000 |
| LogP | 2.19820 |
| Index of Refraction | 1.675 |
| InChIKey | HNZUCGZAMRCFQH-UHFFFAOYSA-N |
| SMILES | CSC1=C(O)c2ccccc2C(=O)C1=O |
|
~%
1,4-Naphthalene... CAS#:31914-17-7 |
|
Literature: Beaumont,P.C.; Edwards,R.L. Journal of the Chemical Society [Section] C: Organic, 1971 , vol. |
|
~%
1,4-Naphthalene... CAS#:31914-17-7 |
|
Literature: Beaumont,P.C.; Edwards,R.L. Journal of the Chemical Society [Section] C: Organic, 1971 , vol. |
|
~%
1,4-Naphthalene... CAS#:31914-17-7 |
|
Literature: Beaumont,P.C.; Edwards,R.L. Journal of the Chemical Society [Section] C: Organic, 1971 , vol. |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-hydroxy-3-methylmercapto-1,4-naphthoquinone |