Uracil, 5-(isopropylamino)-1,6-dimethyl-3-phenyl- structure
|
Common Name | Uracil, 5-(isopropylamino)-1,6-dimethyl-3-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 31992-00-4 | Molecular Weight | 273.33000 | |
| Density | 1.2g/cm3 | Boiling Point | 389.1ºC at 760mmHg | |
| Molecular Formula | C15H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.1ºC | |
| Name | 1,6-dimethyl-3-phenyl-5-(propan-2-ylamino)pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 389.1ºC at 760mmHg |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.33000 |
| Flash Point | 189.1ºC |
| Exact Mass | 273.14800 |
| PSA | 56.03000 |
| LogP | 1.73790 |
| Index of Refraction | 1.596 |
| InChIKey | VVNYZYBWULAGJY-UHFFFAOYSA-N |
| SMILES | Cc1c(NC(C)C)c(=O)n(-c2ccccc2)c(=O)n1C |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Uracil,1,6-dimethyl-5-(isopropylamino)-3-phenyl |
| 5-Isopropylamino-1,6-dimethyl-3-phenyluracil |
| Uracil,5-(isopropylamino)-1,6-dimethyl-3-phenyl |
| 1,6-Dimethyl-5-isopropylamino-3-phenyluracil |
| 2,4(1H,3H)-Pyrimidinedione,1,6-dimethyl-5-isopropylamino-3-phenyl |
| 5-(isopropylamino)-1,6-dimethyl-3-phenylpyrimidine-2,4(1h,3h)-dione |
| 5-isopropylamino-1,6-dimethyl-3-phenyl-1H-pyrimidine-2,4-dione |