2-Nitro-1,4-bis(trifluoromethyl)benzene structure
|
Common Name | 2-Nitro-1,4-bis(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 320-88-7 | Molecular Weight | 259.105 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 209.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H3F6NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 80.5±27.3 °C | |
| Name | 2,5-Bis(trifluoromethyl)nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 209.5±40.0 °C at 760 mmHg |
| Molecular Formula | C8H3F6NO2 |
| Molecular Weight | 259.105 |
| Flash Point | 80.5±27.3 °C |
| Exact Mass | 259.006805 |
| PSA | 45.82000 |
| LogP | 3.72 |
| Vapour Pressure | 0.3±0.4 mmHg at 25°C |
| Index of Refraction | 1.422 |
| InChIKey | BZKVUOHHNCMTLH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S37/39-S26 |
| HS Code | 2904909090 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Nitro-1,4-bis-trifluormethyl-benzol |
| MFCD00236674 |
| 1-Nitro-2,5-bis(trifluoromethyl)benzene |
| 2,5-Bis(trifluoromethyl)nitrobenzene |
| 2-Nitro-1,4-bis(trifluoromethyl)benzene |
| 2,4-DICHLORO-5-NITROPYRIMIDINE |
| FXFFR BNW DXFFF |