2-methyl-3-(3-methylpyridin-2-yl)quinazolin-4-one
Modify Date: 2025-10-02 08:53:31
2-methyl-3-(3-methylpyridin-2-yl)quinazolin-4-one structure
|
Common Name | 2-methyl-3-(3-methylpyridin-2-yl)quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 3214-64-0 | Molecular Weight | 251.28300 | |
| Density | 1.22g/cm3 | Boiling Point | 432.4ºC at 760mmHg | |
| Molecular Formula | C15H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.3ºC | |
| Name | 2-methyl-3-(3-methylpyridin-2-yl)quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 432.4ºC at 760mmHg |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.28300 |
| Flash Point | 215.3ºC |
| Exact Mass | 251.10600 |
| PSA | 47.78000 |
| LogP | 2.39750 |
| Index of Refraction | 1.65 |
| InChIKey | LZORTVCIUAAACZ-UHFFFAOYSA-N |
| SMILES | Cc1cccnc1-n1c(C)nc2ccccc2c1=O |
| HS Code | 2933990090 |
|---|
|
~58%
2-methyl-3-(3-m... CAS#:3214-64-0 |
| Literature: Research Corporation Technologies, Inc. Patent: US5283247 A1, 1994 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Src-820 R |