2,4(1H,3H)-Pteridinedione,1,3,7-trimethyl- structure
|
Common Name | 2,4(1H,3H)-Pteridinedione,1,3,7-trimethyl- | ||
|---|---|---|---|---|
| CAS Number | 32526-79-7 | Molecular Weight | 206.20100 | |
| Density | 1.338g/cm3 | Boiling Point | 377.9ºC at 760 mmHg | |
| Molecular Formula | C9H10N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.3ºC | |
| Name | 1,3,7-trimethylpteridine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.338g/cm3 |
|---|---|
| Boiling Point | 377.9ºC at 760 mmHg |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20100 |
| Flash Point | 182.3ºC |
| Exact Mass | 206.08000 |
| PSA | 69.78000 |
| Index of Refraction | 1.584 |
| InChIKey | AYNMJWQFQJZDLL-UHFFFAOYSA-N |
| SMILES | Cc1cnc2c(=O)n(C)c(=O)n(C)c2n1 |
|
~69%
2,4(1H,3H)-Pter... CAS#:32526-79-7 |
| Literature: Singh; Geetanjali Russian Journal of Organic Chemistry, 2006 , vol. 42, # 1 p. 136 - 138 |
|
~53%
2,4(1H,3H)-Pter... CAS#:32526-79-7 |
| Literature: Baur, Ralph; Kleiner, Erna; Pfleiderer, Wolfgang Liebigs Annalen der Chemie, 1984 , # 11 p. 1798 - 1814 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,3,7-trimethyllumazine |
| 1,3,7-trimethyl-1H-pteridine-2,4-dione |
| 1,3,7-Trimethyl-1H-pteridin-2,4-dion |
| 1,3,7-Trimethylpteridin-2,4-dion |
| 1,3,7-Trimethyl-pteridine |