(1S)-2-oxobornane-10-sulphonic acid, compound with N,N-diethyl-3-phenyl-1,2,4-oxadiazole-5-ethylamine (1:1) structure
|
Common Name | (1S)-2-oxobornane-10-sulphonic acid, compound with N,N-diethyl-3-phenyl-1,2,4-oxadiazole-5-ethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 32601-57-3 | Molecular Weight | 477.61700 | |
| Density | N/A | Boiling Point | 364.8ºC at 760 mmHg | |
| Molecular Formula | C24H35N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.4ºC | |
| Name | N,N-diethyl-2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine,(7,7-dimethyl-3-oxo-4-bicyclo[2.2.1]heptanyl)methanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 364.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C24H35N3O5S |
| Molecular Weight | 477.61700 |
| Flash Point | 174.4ºC |
| Exact Mass | 477.23000 |
| PSA | 121.98000 |
| LogP | 4.97130 |
| InChIKey | JFZBBAUZBXYODI-STOWLHSFSA-N |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2.CCN(CC)CCc1nc(-c2ccccc2)no1 |
| einecs 251-125-4 |