N-(4-Methoxybenzylidene)-N-(4-methoxybenzyl)amine structure
|
Common Name | N-(4-Methoxybenzylidene)-N-(4-methoxybenzyl)amine | ||
|---|---|---|---|---|
| CAS Number | 3261-60-7 | Molecular Weight | 255.31200 | |
| Density | 1.02±0.1 g/cm3(Predicted) | Boiling Point | N/A | |
| Molecular Formula | C16H17NO2 | Melting Point | 37-38 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-methoxyphenyl)-N-[(4-methoxyphenyl)methyl]methanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02±0.1 g/cm3(Predicted) |
|---|---|
| Melting Point | 37-38 °C |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.31200 |
| Exact Mass | 255.12600 |
| PSA | 30.82000 |
| LogP | 3.32290 |
| InChIKey | VULGBGGDBXPNCT-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=NCc2ccc(OC)cc2)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| hms1449b12 |