1H-Pyrrole,2,3,4,5-tetraphenyl
1H-Pyrrole,2,3,4,5-tetraphenyl structure
|
Common Name | 1H-Pyrrole,2,3,4,5-tetraphenyl | ||
|---|---|---|---|---|
| CAS Number | 3263-79-4 | Molecular Weight | 371.47300 | |
| Density | 1.129g/cm3 | Boiling Point | 472.2ºC at 760mmHg | |
| Molecular Formula | C28H21N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3,4,5-tetraphenyl-1H-pyrrole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.129g/cm3 |
|---|---|
| Boiling Point | 472.2ºC at 760mmHg |
| Molecular Formula | C28H21N |
| Molecular Weight | 371.47300 |
| Flash Point | 198.2ºC |
| Exact Mass | 371.16700 |
| PSA | 15.79000 |
| LogP | 7.68270 |
| Index of Refraction | 1.643 |
| InChIKey | IEZVMRGFNUNABR-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2[nH]c(-c3ccccc3)c(-c3ccccc3)c2-c2ccccc2)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933990090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 3 | |
CAS#:26306-06-9
CAS#:10516-92-4
CAS#:10496-80-7
CAS#:451-40-1
CAS#:23190-16-1
CAS#:1215-07-2
CAS#:19690-01-8
CAS#:79919-09-8
CAS#:591-51-5
CAS#:501-65-5
CAS#:642-04-6
CAS#:55-21-0
CAS#:65-85-0This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,3,4,5-TETRAPHENYLPYRROLE |
| 2,3,4,5-Tetraphenyl-pyrrol |
| AGN-PC-0CR6KK |
| 1H-Pyrrole,2,3,4,5-tetraphenyl |
| 2,3,4,5-Tetraphenylpyrrolidin |
| 2,4,5-Tetraphenylpyrrole |
| Tetraphenylpyrrole |
| 2,3,4,5-tetraphenyl-pyrrole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2,3,4,5-tetraphenyl-1H-pyrrole? |
| A: Molecular formula of 2,3,4,5-tetraphenyl-1H-pyrrole is C28H21N. |
| Q: What is the polar surface area (PSA) of 2,3,4,5-tetraphenyl-1H-pyrrole? |
| A: Polar surface area (PSA) of 2,3,4,5-tetraphenyl-1H-pyrrole is 15.79000. |
| Q: What is the SMILES notation of 2,3,4,5-tetraphenyl-1H-pyrrole? |
| A: SMILES notation of 2,3,4,5-tetraphenyl-1H-pyrrole is c1ccc(-c2[nH]c(-c3ccccc3)c(-c3ccccc3)c2-c2ccccc2)cc1. |
| Q: What is the English name of 2,3,4,5-tetraphenyl-1H-pyrrole? |
| A: The English name of 2,3,4,5-tetraphenyl-1H-pyrrole is 2,3,4,5-tetraphenyl-1H-pyrrole. |
| Q: What is the CAS number of 2,3,4,5-tetraphenyl-1H-pyrrole? |
| A: CAS number of 2,3,4,5-tetraphenyl-1H-pyrrole is 3263-79-4. |
| Q: What is the molecular weight of 2,3,4,5-tetraphenyl-1H-pyrrole? |
| A: Molecular weight of 2,3,4,5-tetraphenyl-1H-pyrrole is 371.47300. |
| Q: What is the LogP of 2,3,4,5-tetraphenyl-1H-pyrrole? |
| A: LogP of 2,3,4,5-tetraphenyl-1H-pyrrole is 7.68270. |
| Q: What is the boiling point of 2,3,4,5-tetraphenyl-1H-pyrrole? |
| A: Boiling point of 2,3,4,5-tetraphenyl-1H-pyrrole is 472.2ºC at 760mmHg. |
| Q: What are the downstream products of 2,3,4,5-tetraphenyl-1H-pyrrole? |
| A: Related downstream products(CAS) of 2,3,4,5-tetraphenyl-1H-pyrrole: 642-04-6;55-21-0;65-85-0. |
| Q: What is the Chinese name of 3263-79-4? |
| A: Chinese name of 3263-79-4 is 3263-79-4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |