1H-Pyrrole,2,3,4,5-tetraphenyl structure
|
Common Name | 1H-Pyrrole,2,3,4,5-tetraphenyl | ||
|---|---|---|---|---|
| CAS Number | 3263-79-4 | Molecular Weight | 371.47300 | |
| Density | 1.129g/cm3 | Boiling Point | 472.2ºC at 760mmHg | |
| Molecular Formula | C28H21N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.2ºC | |
| Name | 2,3,4,5-tetraphenyl-1H-pyrrole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.129g/cm3 |
|---|---|
| Boiling Point | 472.2ºC at 760mmHg |
| Molecular Formula | C28H21N |
| Molecular Weight | 371.47300 |
| Flash Point | 198.2ºC |
| Exact Mass | 371.16700 |
| PSA | 15.79000 |
| LogP | 7.68270 |
| Index of Refraction | 1.643 |
| InChIKey | IEZVMRGFNUNABR-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2[nH]c(-c3ccccc3)c(-c3ccccc3)c2-c2ccccc2)cc1 |
| HS Code | 2933990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3,4,5-TETRAPHENYLPYRROLE |
| 2,3,4,5-Tetraphenyl-pyrrol |
| AGN-PC-0CR6KK |
| 1H-Pyrrole,2,3,4,5-tetraphenyl |
| 2,3,4,5-Tetraphenylpyrrolidin |
| 2,4,5-Tetraphenylpyrrole |
| Tetraphenylpyrrole |
| 2,3,4,5-tetraphenyl-pyrrole |