Deoxybenzoin Oxime structure
|
Common Name | Deoxybenzoin Oxime | ||
|---|---|---|---|---|
| CAS Number | 26306-06-9 | Molecular Weight | 211.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Deoxybenzoin Oxime |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13NO |
|---|---|
| Molecular Weight | 211.25900 |
| Exact Mass | 211.10000 |
| PSA | 32.59000 |
| LogP | 3.10760 |
| InChIKey | PWCUVRROUAKTLL-CCEZHUSRSA-N |
| SMILES | C1=CC=C(C=C1)C/C(=NO)/C2=CC=CC=C2 |
| HS Code | 2928000090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| deoxybenzoin-seqtrans-oxime |
| DeoxyBenzoinOxime |
| benzyl phenyl ketoxime |
| (E)-1,2-diphenylethanone oxime |
| 1,2-Diphenylethanone oxime |
| Desoxybenzoin-seqtrans-oxim |