1-ACETYL-5-INDOLINESULFONAMIDE structure
|
Common Name | 1-ACETYL-5-INDOLINESULFONAMIDE | ||
|---|---|---|---|---|
| CAS Number | 3264-38-8 | Molecular Weight | 240.27900 | |
| Density | 1.415g/cm3 | Boiling Point | 564.9ºC at 760mmHg | |
| Molecular Formula | C10H12N2O3S | Melting Point | 225-227ºC | |
| MSDS | N/A | Flash Point | 295.4ºC | |
| Name | 1-acetyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.415g/cm3 |
|---|---|
| Boiling Point | 564.9ºC at 760mmHg |
| Melting Point | 225-227ºC |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.27900 |
| Flash Point | 295.4ºC |
| Exact Mass | 240.05700 |
| PSA | 88.85000 |
| LogP | 2.08910 |
| Index of Refraction | 1.62 |
| InChIKey | CIIBOYDDEVWHOY-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCc2cc(S(N)(=O)=O)ccc21 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2935009090 |
|
~95%
1-ACETYL-5-INDO... CAS#:3264-38-8 |
| Literature: BRISTOL-MYERS SQUIBB COMPANY; BORZILLERI, Robert M.; CAI, Zhen-wei; TEBBEN, Andrew J.; PEREZ, Heidi L.; ZHANG, Liping; SCHROEDER, Gretchen M.; WEI, Donna D. Patent: WO2012/162365 A1, 2012 ; Location in patent: Page/Page column 141-142 ; WO 2012/162365 A1 |
|
~53%
1-ACETYL-5-INDO... CAS#:3264-38-8 |
| Literature: ELI LILLY AND COMPANY Patent: EP614887 A1, 1994 ; |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 1-Acetylindolin-5-sulfonamid |
| 1-acetylindoline-5-sulfonamide |
| acetylindolinesulfonamide |
| 1-acetyl-2,3-dihydro-indole-5-sulfonic acid amide |
| N-acetyl indoline-5-sulfonamide |
| 5-Sulfamoyl-1-acetyl-indolin |