WAY-240932 structure
|
Common Name | WAY-240932 | ||
|---|---|---|---|---|
| CAS Number | 326914-66-3 | Molecular Weight | 363.22904 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11BrN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-240932serine/threonine kinase inhibitors and compns. for increasing the sensitivity of bacterial pathogens to b-lactam antibiotics. |
| Name | WAY-240932 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H11BrN2O2S |
|---|---|
| Molecular Weight | 363.22904 |
| InChIKey | SKWPMLLBLRFMJW-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Nc1ccccc1Br)c1cccc2cccnc12 |
| 8-Quinolinesulfonamide, N-(2-bromophenyl)- |