WYE-175829 structure
|
Common Name | WYE-175829 | ||
|---|---|---|---|---|
| CAS Number | 327093-01-6 | Molecular Weight | 278.32686 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 487.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C13H14N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.3±31.5 °C | |
Use of WYE-175829inhibitor of tyrosine kinases; gonadotropin-releasing hormone antagonist; |
| Name | WYE-175829 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 487.0±55.0 °C at 760 mmHg |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.32686 |
| Flash Point | 248.3±31.5 °C |
| Exact Mass | 278.072510 |
| LogP | 1.06 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | IRJQKCUTGSZFON-UHFFFAOYSA-N |
| SMILES | COc1ccccc1NS(=O)(=O)c1cccc(N)c1 |
| 3-Amino-N-(2-methoxyphenyl)benzenesulfonamide |
| Benzenesulfonamide, 3-amino-N-(2-methoxyphenyl)- |
| MFCD02708235 |
| 3-Amino-N-(2-methoxy-phenyl)-benzenesulfonamide |