Sodium phenyl phosphate structure
|
Common Name | Sodium phenyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 3279-54-7 | Molecular Weight | 218.055 | |
| Density | 1.499g/cm3 | Boiling Point | 346.9ºC at 760mmHg | |
| Molecular Formula | C6H5Na2O4P | Melting Point | >300°C | |
| MSDS | N/A | Flash Point | 163.6ºC | |
| Name | phenyl phosphate disodium salt |
|---|---|
| Synonym | More Synonyms |
| Density | 1.499g/cm3 |
|---|---|
| Boiling Point | 346.9ºC at 760mmHg |
| Melting Point | >300°C |
| Molecular Formula | C6H5Na2O4P |
| Molecular Weight | 218.055 |
| Flash Point | 163.6ºC |
| Exact Mass | 217.972092 |
| PSA | 82.23000 |
| LogP | 2.03450 |
| InChIKey | TYJOJLOWRIQYQM-UHFFFAOYSA-L |
| SMILES | O=P([O-])([O-])Oc1ccccc1.[Na+].[Na+] |
| Storage condition | 2-8°C |
| Water Solubility | H2O: 0.1 g/mL, clear |
| Hazard Codes | F,C |
|---|---|
| Risk Phrases | R11:Highly Flammable. R34:Causes burns. |
| Safety Phrases | S22-S24/25 |
| WGK Germany | 3 |
| HS Code | 2919900090 |
|
~%
Sodium phenyl p... CAS#:3279-54-7 |
| Literature: Tetrahedron, , vol. 54, # 30 p. 8841 - 8846 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| phenyl disodium orthophosphate |
| Phosphoric acid, phenyl ester, sodium salt (1:2) |
| Phosphoric Acid Phenyl Ester Disodium Salt Hydrate |
| Phenylphosphoric Aci |
| Disodinmphenylphosphate |
| PHENYL DISODIUM PHOSPHATE |
| Disodium phenylphosphate |
| PhenylPhosphateDisodiumSaltGr |
| DisodiuM Phenyl Phosphate Hydrate |
| DISODIUM PHENYL-(O)-PHOSPHATE |
| EINECS 221-917-4 |
| Disodium phenyl phosphate |
| Sodium phenyl phosphate |
| MFCD00002133 |
| Disodiumphenylphosphate,dihy |