3-Bromo-5-trifluoromethyl-benzoic acid structure
|
Common Name | 3-Bromo-5-trifluoromethyl-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 328-67-6 | Molecular Weight | 269.015 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 284.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H4BrF3O2 | Melting Point | 132.3-132.8ºC | |
| MSDS | N/A | Flash Point | 125.8±27.3 °C | |
| Name | 3-Bromo-5-(trifluoromethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 284.3±40.0 °C at 760 mmHg |
| Melting Point | 132.3-132.8ºC |
| Molecular Formula | C8H4BrF3O2 |
| Molecular Weight | 269.015 |
| Flash Point | 125.8±27.3 °C |
| Exact Mass | 267.934662 |
| PSA | 37.30000 |
| LogP | 3.46 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.517 |
| InChIKey | AMZBKZQMAZWIJM-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Br)cc(C(F)(F)F)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2916399090 |
| Precursor 6 | |
|---|---|
| DownStream 5 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-Bromo-5-(trifluoromethyl)benzoic acid |
| 3-Bromo-5-trifluoromethyl-benzoic acid |
| 3-Bromo-5-trifluoromethylbenzoic acid |
| Benzoic acid, 3-bromo-5-(trifluoromethyl)- |
| MFCD03412186 |