2-Amino-3-(trifluoromethyl)benzoic acid structure
|
Common Name | 2-Amino-3-(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 328-68-7 | Molecular Weight | 205.134 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 331.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C8H6F3NO2 | Melting Point | 141-146 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 154.5±27.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-Amino-5-(trifluoromethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 331.9±42.0 °C at 760 mmHg |
| Melting Point | 141-146 °C(lit.) |
| Molecular Formula | C8H6F3NO2 |
| Molecular Weight | 205.134 |
| Flash Point | 154.5±27.9 °C |
| Exact Mass | 205.035065 |
| PSA | 63.32000 |
| LogP | 2.72 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | WBTHOSZMTIPJLR-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(=O)O)cc(C(F)(F)F)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DD6205700 |
| HS Code | 2922499990 |
|
~99%
2-Amino-3-(trif... CAS#:328-68-7 |
| Literature: Shirai, Junya; Morimoto, Shinji; Sugiyama, Hideyuki; Sakauchi, Nobuki; Yoshikawa, Takeshi Patent: US2008/275085 A1, 2008 ; Location in patent: Page/Page column 45 ; US 20080275085 A1 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3-amino-5-trifluoromethyl benzoic acid |
| MFCD00236641 |
| Benzoic acid, 3-amino-5-(trifluoromethyl)- |
| Benzoic acid, 2-amino-3-(trifluoromethyl)- |
| 3-Amino-5-trifluormethyl-benzoesaeure |
| 2-Amino-3-(trifluoromethyl)benzoic acid |
| 3-Amino-5-(trifluoromethyl)benzoic acid |