Cholesteryl 2,4-Dichlorobenzoate structure
|
Common Name | Cholesteryl 2,4-Dichlorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 32832-01-2 | Molecular Weight | 559.65000 | |
| Density | 1.13 g/cm3 | Boiling Point | 600.4ºC at 760 mmHg | |
| Molecular Formula | C34H48Cl2O2 | Melting Point | 126°C | |
| MSDS | N/A | Flash Point | 153.7ºC | |
| Name | [(3S,8S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,4-dichlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13 g/cm3 |
|---|---|
| Boiling Point | 600.4ºC at 760 mmHg |
| Melting Point | 126°C |
| Molecular Formula | C34H48Cl2O2 |
| Molecular Weight | 559.65000 |
| Flash Point | 153.7ºC |
| Exact Mass | 558.30300 |
| PSA | 26.30000 |
| LogP | 10.56020 |
| Index of Refraction | 1.559 |
| InChIKey | NZZFKZMKJPWVDL-XBGNAKIGSA-N |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)c5ccc(Cl)cc5Cl)CCC4(C)C3CCC12C |
| Hazard Codes | F,Xn,T |
|---|---|
| Risk Phrases | R11:Highly Flammable. R38:Irritating to the skin. R48/20:Harmful: danger of serious damage to health by prolonged exposure through inhalation . R63:Possible risk of harm to the unborn child. R65:Harmful: May cause lung damage if swallowed. R67:Vapors may c |
| Safety Phrases | S36/37-S46-S62-S45-S16-S7 |
| RIDADR | UN 1294 3/PG 2 |
| WGK Germany | 1 |
| Packaging Group | II |
| Hazard Class | 3 |
| cholest-5-en-3beta-yl 2,4-dichlorobenzoate |
| EINECS 251-248-3 |
| Cholesteryl |
| Cholesteroldichlorobenzoate |
| CHOLESTEROL 2,4-DICHLOROBENZOATE |
| Cholesteryl 2,4-Dichlorobenzoate |
| CHOLESTERYL 2,4-DICHLOROBEZOATE |
| Cholestreyl 2,4-dichlorobenzoate |
| MFCD07776849 |