methyl 2,3,4,6-tetra-O-benzoyl-α-D-altropyranoside
Modify Date: 2025-09-13 17:43:19
methyl 2,3,4,6-tetra-O-benzoyl-α-D-altropyranoside structure
|
Common Name | methyl 2,3,4,6-tetra-O-benzoyl-α-D-altropyranoside | ||
|---|---|---|---|---|
| CAS Number | 32849-03-9 | Molecular Weight | 610.60700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H30O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-O-methyl-2,3,4,6-tetra-O-benzoyl-α-D-glucopyranose |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C35H30O10 |
|---|---|
| Molecular Weight | 610.60700 |
| Exact Mass | 610.18400 |
| PSA | 123.66000 |
| LogP | 4.89150 |
| InChIKey | OSFLTUBNBXWBHG-HOUGBNEZSA-N |
| SMILES | COC1OC(COC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:34234-44-1|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| 2,3.4,6-tetra-O-benzoyl-α-D-glucopyranoside |
| methyl 2,3,4,6-tetra-O-benzoyl-α-D-glucopyranosyl |
| methyl 2,3,4,6-tetra-O-benzoyl-α-D-altropyranoside |
| methyl tetra-O-benzoyl-α-D-glucopyranoside |
| methyl 2,3,4,6-tetra-O-benzoyl-α-D-glucopyranoside |
| methyl 2,3,4,6-tetra-O-benzoyl-α-D-glycopyranoside |