H-Ala-Leu-OH structure
|
Common Name | H-Ala-Leu-OH | ||
|---|---|---|---|---|
| CAS Number | 3303-34-2 | Molecular Weight | 202.25100 | |
| Density | 1.108g/cm3 | Boiling Point | 409.7ºC at 760mmHg | |
| Molecular Formula | C9H18N2O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 201.6ºC | |
Use of H-Ala-Leu-OHL-Alanyl-L-leucine is an endogenous metabolite. |
| Name | (2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-methylpentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | L-Alanyl-L-leucine is an endogenous metabolite. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| Density | 1.108g/cm3 |
|---|---|
| Boiling Point | 409.7ºC at 760mmHg |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25100 |
| Flash Point | 201.6ºC |
| Exact Mass | 202.13200 |
| PSA | 92.42000 |
| LogP | 1.04030 |
| Index of Refraction | 1.485 |
| InChIKey | RDIKFPRVLJLMER-BQBZGAKWSA-N |
| SMILES | CC(C)CC(NC(=O)C(C)N)C(=O)O |
| Storage condition | −20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924199090 |
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Transport and signaling via the amino acid binding site of the yeast Gap1 amino acid transceptor.
Nat. Chem. Biol. 5 , 45-52, (2009) Transporter-related nutrient sensors, called transceptors, mediate nutrient activation of signaling pathways through the plasma membrane. The mechanism of action of transporting and nontransporting tr... |
|
|
Differential mobility spectrometry of isomeric protonated dipeptides: modifier and field effects on ion mobility and stability.
Anal. Chem. 83 , 3470-3476, (2011) The ability to resolve isomeric protonated dipeptides was investigated with the new technique of differential ion mobility mass spectrometry that uses "modifier" molecules to enhance differential mobi... |
|
|
Infrared spectroscopy of the alanine dipeptide analog in liquid water with DFT-MD. Direct evidence for P(II)/beta conformations.
Phys. Chem. Chem. Phys. 12 , 10198-10209, (2010) Following our previous work [J. Phys. Chem. B. Lett., 2009, 113, 10059], DFT-based molecular dynamics (DFTMD) simulations of 2-Ala peptide (i.e. Ac-Ala-NHMe dialanine peptide analog with methyl group ... |
| N-L-alanyl-L-leucine |
| Ala-Leu-OH |
| EINECS 221-977-1 |
| ALA-LEU |
| alanineleucine |
| L-ALANYL-L-LEUCINE extrapure |
| H-ALA-LEU-OH |
| alanylleucine |
| L-alanyl-leucine |
| H-SS-ALA-LEU-OH |
| L-ALANYL-L-LEUCINE |
| MFCD00065106 |
| H2N-Ala-Leu-OH |
| L-Ala-L-Leu-OH |
| H-β-Ala-Leu-OH |