Bis(4-nitrophenyl) glutarate structure
|
Common Name | Bis(4-nitrophenyl) glutarate | ||
|---|---|---|---|---|
| CAS Number | 33109-59-0 | Molecular Weight | 374.30200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Bis(4-nitrophenyl) glutarate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H14N2O8 |
|---|---|
| Molecular Weight | 374.30200 |
| Exact Mass | 374.07500 |
| PSA | 144.24000 |
| LogP | 4.23070 |
| InChIKey | IOIJXIHQQRSQDS-UHFFFAOYSA-N |
| SMILES | O=C(CCCC(=O)Oc1ccc([N+](=O)[O-])cc1)Oc1ccc([N+](=O)[O-])cc1 |
|
~%
Bis(4-nitrophen... CAS#:33109-59-0 |
| Literature: Zahn,H.; Schade,F. Chemische Berichte, 1963 , vol. 96, p. 1747 - 1750 |
|
~%
Bis(4-nitrophen... CAS#:33109-59-0 |
| Literature: Ashley et al. Journal of the Chemical Society, 1958 , p. 3298,3308 |
| di-p-nitrophenyl glutarate |
| glutaric acid bis-(4-nitro-phenyl ester) |
| bis-p-nitrophenyl glutarate |
| Glutarsaeure-bis-<4-nitro-phenylester> |
| glutaric acid bis-(2-hydroxy-ethyl ester) |
| Glutarsaeure-bis-(2-hydroxy-aethylester) |
| Pentanedioic acid,1,5-bis(2-hydroxyethyl) ester |
| Bis(2-hydroxyethyl) glutarate |