(2E)-3-(2,3,4-Trimethoxyphenyl)acrylic acid structure
|
Common Name | (2E)-3-(2,3,4-Trimethoxyphenyl)acrylic acid | ||
|---|---|---|---|---|
| CAS Number | 33130-03-9 | Molecular Weight | 238.237 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 392.2±37.0 °C at 760 mmHg | |
| Molecular Formula | C12H14O5 | Melting Point | 172-174 °C | |
| MSDS | N/A | Flash Point | 149.7±20.0 °C | |
| Name | trans-2,3,4-Trimethoxycinnamic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 392.2±37.0 °C at 760 mmHg |
| Melting Point | 172-174 °C |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.237 |
| Flash Point | 149.7±20.0 °C |
| Exact Mass | 238.084122 |
| PSA | 64.99000 |
| LogP | 2.03 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | ZYOPDNLIHHFGEC-FNORWQNLSA-N |
| SMILES | COc1ccc(C=CC(=O)O)c(OC)c1OC |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S37/39-S26 |
| HS Code | 2918990090 |
|
~%
(2E)-3-(2,3,4-T... CAS#:33130-03-9 |
| Literature: Molecules, , vol. 14, # 10 p. 4166 - 4179 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,3,4-Trimethoxy-trans-cinnamic acid |
| 2,3,4-Trimethoxyzimtsaeure |
| Trans-2,3,4-Trimethoxycinnam |
| 2,3,4-trimethoxycinnamic acid |
| trans-2,3,4-Trimethoxycinnamic |
| MFCD00014376 |
| 2-Propenoic acid, 3-(2,3,4-trimethoxyphenyl)- |
| 3-(2,3,4-Trimethoxyphenyl)acrylic acid |
| (2E)-3-(2,3,4-Trimethoxyphenyl)acrylic acid |
| RARECHEM BK HC T327 |
| 2,3,4,5,6-PENTAFLUOROPHENYL PHENYLMETHANESULPHONATE |
| 2-Propenoic acid, 3-(2,3,4-trimethoxyphenyl)-, (2E)- |
| EINECS 251-388-5 |