Ethyl 3-(3-chlorophenyl)-3-oxopropanoate structure
|
Common Name | Ethyl 3-(3-chlorophenyl)-3-oxopropanoate | ||
|---|---|---|---|---|
| CAS Number | 33167-21-4 | Molecular Weight | 226.656 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 312.5±22.0 °C at 760 mmHg | |
| Molecular Formula | C11H11ClO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 127.4±21.3 °C | |
| Name | ethyl 3-(3-chlorophenyl)-3-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 312.5±22.0 °C at 760 mmHg |
| Molecular Formula | C11H11ClO3 |
| Molecular Weight | 226.656 |
| Flash Point | 127.4±21.3 °C |
| Exact Mass | 226.039673 |
| PSA | 43.37000 |
| LogP | 2.72 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | WWFYJJHEBDWEJF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1cccc(Cl)c1 |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918300090 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Ethyl 3-(3-chlorophenyl)-3-oxo-propanoate |
| MFCD03424810 |
| Benzenepropanoic acid, 3-chloro-β-oxo-, ethyl ester |
| Ethyl 3-(3-chlorophenyl)-3-oxopropanoate |