Denaverine structure
|
Common Name | Denaverine | ||
|---|---|---|---|---|
| CAS Number | 3321-06-0 | Molecular Weight | 419.98500 | |
| Density | N/A | Boiling Point | 489.9ºC at 760mmHg | |
| Molecular Formula | C24H34ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.1ºC | |
| Name | 2-(dimethylamino)ethyl 2-(2-ethylbutoxy)-2,2-diphenylacetate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 489.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C24H34ClNO3 |
| Molecular Weight | 419.98500 |
| Flash Point | 250.1ºC |
| Exact Mass | 419.22300 |
| PSA | 38.77000 |
| LogP | 5.28980 |
| InChIKey | RSDBEODKTNUEMS-UHFFFAOYSA-N |
| SMILES | CCC(CC)COC(C(=O)OCCN(C)C)(c1ccccc1)c1ccccc1.Cl |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| UNII-2AFK8FCD4R |
| Denaverine hydrochloride |
| Denaverinhydrochlorid |