a-D-erythro-Hex-2-enopyranoside,ethyl 2,3-dideoxy-, 4,6-diacetate structure
|
Common Name | a-D-erythro-Hex-2-enopyranoside,ethyl 2,3-dideoxy-, 4,6-diacetate | ||
|---|---|---|---|---|
| CAS Number | 3323-72-6 | Molecular Weight | 258.26800 | |
| Density | 1.16g/cm3 | Boiling Point | 335.1ºC at 760mmHg | |
| Molecular Formula | C12H18O6 | Melting Point | 77-79ºC(lit.) | |
| MSDS | N/A | Flash Point | 145.2ºC | |
| Name | ETHYL 4,6-DI-O-ACETYL-2,3-DIDEOXY-α-D-ERYTHRO-HEX-2-ENOPYRANOSIDE |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 335.1ºC at 760mmHg |
| Melting Point | 77-79ºC(lit.) |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.26800 |
| Flash Point | 145.2ºC |
| Exact Mass | 258.11000 |
| PSA | 71.06000 |
| LogP | 0.79880 |
| Index of Refraction | 1.475 |
| InChIKey | OSPOBRCWZOKNRC-UHFFFAOYSA-N |
| SMILES | CCOC1C=CC(OC(C)=O)C(COC(C)=O)O1 |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2932999099 |
| Precursor 8 | |
|---|---|
| DownStream 6 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| ethyl 4,6-di-O-acetyl-2,3-dideoxy-D-er-hexenopyranoside |
| MFCD00040569 |
| (+)-ETHYL-4,6-DI-O-ACETYL-2,3-DIDEOXYA-D |