(9,9-Dimethyl-9H-fluoren-2-yl)boronic acid structure
|
Common Name | (9,9-Dimethyl-9H-fluoren-2-yl)boronic acid | ||
|---|---|---|---|---|
| CAS Number | 333432-28-3 | Molecular Weight | 238.089 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 436.5±48.0 °C at 760 mmHg | |
| Molecular Formula | C15H15BO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.8±29.6 °C | |
| Name | (9,9-dimethylfluoren-2-yl)boronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 436.5±48.0 °C at 760 mmHg |
| Molecular Formula | C15H15BO2 |
| Molecular Weight | 238.089 |
| Flash Point | 217.8±29.6 °C |
| Exact Mass | 238.116516 |
| PSA | 40.46000 |
| LogP | 4.57 |
| Appearance of Characters | Solid |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | DMDPAJOXRYGXCB-UHFFFAOYSA-N |
| SMILES | CC1(C)c2ccccc2-c2ccc(B(O)O)cc21 |
| Precursor 5 | |
|---|---|
| DownStream 6 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Boronic acid, B-(9,9-dimethyl-9H-fluoren-2-yl)- |
| 9,9-Dimethylfluoren-2-boronic acid |
| 9,9-Dimethyl-9H-fluorene-2-yl-2-boronic acid |
| 9,9-dimethyl-9H-fluorene-2-yl-boronic acid |
| 2-(9,9-dimethylfluorenyl)boronic acid |
| (9,9-Dimethyl-9H-fluoren-2-yl)boronic acid |
| 9,9-Dimethyl-9H-fluoren-2-yl-boronic acid |
| 9,9-dimethylfluoren-2-ylboronic acid |
| 9,9-dimethyl-2-fluorene boronic acid |
| 9,9-dimethyl-9H-fluoren-2-ylboronic acid |