Lubiprostone structure
|
Common Name | Lubiprostone | ||
|---|---|---|---|---|
| CAS Number | 333963-40-9 | Molecular Weight | 390.462 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 532.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H32F2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.7±30.1 °C | |
Use of LubiprostoneLubiprostone, also known as RU-0211, is a medication used in the management of chronic idiopathic constipation, predominantly irritable bowel syndrome-associated constipation in women and opioid-induced constipation. It was initially approved by the U.S. Food and Drug Administration (FDA) in 2006. Lubiprostone is a bicyclic fatty acid derived from prostaglandin E1 that acts by specifically activating ClC-2 chloride channels on the apical aspect of gastrointestinal epithelial cells, producing a chloride-rich fluid secretion. These secretions soften the stool, increase motility, and promote spontaneous bowel movements (SBM). |
| Name | (2R,4aR,5R,7aR)-2-(1,1-Difluoropentyl)-2-hydroxy-6-oxo-3,4,4a,5,7,7a-hexahydrocyclopenta[b]pyran-5-heptanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 532.3±50.0 °C at 760 mmHg |
| Molecular Formula | C20H32F2O5 |
| Molecular Weight | 390.462 |
| Flash Point | 275.7±30.1 °C |
| Exact Mass | 390.221771 |
| PSA | 83.83000 |
| LogP | 2.85 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.486 |
| InChIKey | WGFOBBZOWHGYQH-MXHNKVEKSA-N |
| SMILES | CCCCC(F)(F)C1(O)CCC2C(CC(=O)C2CCCCCCC(=O)O)O1 |
| Hazard Codes | Xn |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (2R,4aR,5R,7aR)-2-(1,1-Difluoropentyl)-2-hydroxy-6-oxo-3,4,4a,5,7,7a-hexahydrocyclopenta[b]pyran-5-h |
| 7-[(2R,4aR,5R,7aR)-2-(1,1-difluoropentyl)-2-hydroxy-6-oxooctahydrocyclopenta[b]pyran-5-yl]heptanoic acid |
| Prostan-1-oic acid, 11,15-epoxy-16,16-difluoro-15-hydroxy-9-oxo-, (11α,15R)- |
| Spi 0211 |
| Lubiprostone |
| Prostan-1-oic acid,11,15-epoxy-16,16-difluoro-15-hydroxy-9-oxo-,(11alpha,15R) |
| (11α,15R)-16,16-Difluoro-15-hydroxy-9-oxo-11,15-epoxyprostan-1-oic acid |
| 7-[(2R,4aR,5R,7aR)-2-(1,1-difluoropentyl)-2-hydroxy-6-oxooctahydrocyclopenta[b]pyran-5-yI]heptanoic acid |
| [3H]-Lubiprostone |
| Unii-7662kg2R6k |
| (-)-7-[(2R,4aR,5R,7aR)-2-(1,1-difluoropentyl)-2-hydroxy-6-oxooctahydrocyclopenta[b]pyran-5-yl]heptanoic acid |