Dunnione structure
|
Common Name | Dunnione | ||
|---|---|---|---|---|
| CAS Number | 33404-57-8 | Molecular Weight | 242.27000 | |
| Density | 1.24g/cm3 | Boiling Point | 370.9ºC at 760mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.5ºC | |
Use of DunnioneDunnione (CompoundⅠ) is a pigment. Dunnione can be isolated from the leaves of Didymocarpus pedicellata[1]. |
| Name | 2,3,3-trimethyl-2H-benzo[g][1]benzofuran-4,5-dione |
|---|
| Description | Dunnione (CompoundⅠ) is a pigment. Dunnione can be isolated from the leaves of Didymocarpus pedicellata[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 370.9ºC at 760mmHg |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27000 |
| Flash Point | 164.5ºC |
| Exact Mass | 242.09400 |
| PSA | 43.37000 |
| LogP | 2.60800 |
| Index of Refraction | 1.592 |
| InChIKey | WGENOABUKBFVAA-MRVPVSSYSA-N |
| SMILES | CC1OC2=C(C(=O)C(=O)c3ccccc32)C1(C)C |
| HS Code | 2932999099 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |