ac1l3bm1 structure
|
Common Name | ac1l3bm1 | ||
|---|---|---|---|---|
| CAS Number | 3345-29-7 | Molecular Weight | 352.222 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 259.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C16H8F8 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 96.0±19.1 °C | |
| Name | ac1l3bm1 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 259.3±40.0 °C at 760 mmHg |
| Molecular Formula | C16H8F8 |
| Molecular Weight | 352.222 |
| Flash Point | 96.0±19.1 °C |
| Exact Mass | 352.049835 |
| LogP | 3.53 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.490 |
| InChIKey | KCKIWSAAWFKXMA-UHFFFAOYSA-N |
| SMILES | FC1(F)c2ccc(cc2)C(F)(F)C(F)(F)c2ccc(cc2)C1(F)F |
| RIDADR | NONH for all modes of transport |
|---|
| parylene AF4 |
| Tricyclo[8.2.2.2]hexadeca-4,6,10,12,13,15-hexaene, 2,2,3,3,8,8,9,9-octafluoro- |
| 2,2,3,3,8,8,9,9-Octafluorotricyclo[8.2.2.2]hexadeca-1(12),4,6,10,13,15-hexaene |