1,4-Bis(bromodifluoromethyl)benzene structure
|
Common Name | 1,4-Bis(bromodifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 651-12-7 | Molecular Weight | 335.919 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | 235.5±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H4Br2F4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 96.2±25.9 °C | |
| Name | 1,4-bis[bromo(difluoro)methyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 235.5±35.0 °C at 760 mmHg |
| Molecular Formula | C8H4Br2F4 |
| Molecular Weight | 335.919 |
| Flash Point | 96.2±25.9 °C |
| Exact Mass | 333.861572 |
| LogP | 5.34 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.509 |
| InChIKey | LVNDZUPLJHHVKR-UHFFFAOYSA-N |
| SMILES | FC(F)(Br)c1ccc(C(F)(F)Br)cc1 |
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2903999090 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| α,α',-Dibromo-α,α,α',α'-tetrafluoro-p-xylene |
| FXFER DXFFE |
| cl9153 |
| 1,4-Bis(bromodifluoromethyl)benzene |
| 1,4-Bis[bromo(difluoro)methyl]benzene |
| Benzene, 1,4-bis(bromodifluoromethyl)- |
| pc8833 |